C51H36F3N3O10 — CID 90813976
2-[(4-methoxyphenyl)methoxy]isoindole-1,3-dione;2-(naphthalen-1-ylmethoxy)isoindole-1,3-dione;2-[[4-(trifluoromethyl)phenyl]methoxy]isoindole-1,3-dione (PubChem CID 90813976) has the molecular formula C51H36F3N3O10 and a molecular weight of 907.85 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]isoindole-1,3-dione;2-(naphthalen-1-ylmethoxy)isoindole-1,3-dione;2-[[4-(trifluoromethyl)phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]isoindole-1,3-dione;2-(naphthalen-1-ylmethoxy)isoindole-1,3-dione;2-[[4-(trifluoromethyl)phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90813976 |
| Molecular Formula | C51H36F3N3O10 |
| Molecular Weight | 907.85 g/mol |
| Exact Mass | 907.24 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]isoindole-1,3-dione;2-(naphthalen-1-ylmethoxy)isoindole-1,3-dione;2-[[4-(trifluoromethyl)phenyl]methoxy]isoindole-1,3-dione |
| SMILES | COc1ccc(CON2C(=O)c3ccccc3C2=O)cc1.O=C1c2ccccc2C(=O)N1OCc1ccc(C(F)(F)F)cc1.O=C1c2ccccc2C(=O)N1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H13NO3.C16H10F3NO3.C16H13NO4/c21-18-16-10-3-4-11-17(16)19(22)20(18)23-12-14-8-5-7-13-6-1-2-9-15(13)14;17-16(18,19)11-7-5-10(6-8-11)9-23-20-14(21)12-3-1-2-4-13(12)15(20)22;1-20-12-8-6-11(7-9-12)10-21-17-15(18)13-4-2-3-5-14(13)16(17)19/h1-11H,12H2;1-8H,9H2;2-9H,10H2,1H3 |
| InChIKey | HNULLSRGXXAJQC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 149.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.85 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|