C26H32N2S4 — CID 154720780
(2S,3S,12bS)-3-[2-(1,3-dithian-2-ylidene)ethyl]-2-(1,3-dithian-2-ylidenemethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine (PubChem CID 154720780) has the molecular formula C26H32N2S4 and a molecular weight of 500.82 g/mol. Its IUPAC name is (2S,3S,12bS)-3-[2-(1,3-dithian-2-ylidene)ethyl]-2-(1,3-dithian-2-ylidenemethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine.
| Compound Name | (2S,3S,12bS)-3-[2-(1,3-dithian-2-ylidene)ethyl]-2-(1,3-dithian-2-ylidenemethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 154720780 |
| Molecular Formula | C26H32N2S4 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (2S,3S,12bS)-3-[2-(1,3-dithian-2-ylidene)ethyl]-2-(1,3-dithian-2-ylidenemethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine |
| SMILES | C(C[C@@H]1CN2CCc3c([nH]c4ccccc34)[C@@H]2C[C@@H]1C=C1SCCCS1)=C1SCCCS1 |
| InChI | InChI=1S/C26H32N2S4/c1-2-6-22-20(5-1)21-9-10-28-17-18(7-8-24-29-11-3-12-30-24)19(15-23(28)26(21)27-22)16-25-31-13-4-14-32-25/h1-2,5-6,8,16,18-19,23,27H,3-4,7,9-15,17H2/t18-,19-,23+/m1/s1 |
| InChIKey | SJLFVFFHZXITNL-PWHSHALESA-N |
| XLogP | 7.52 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|