C18H23F2N3O — CID 154721217
3-(difluoromethyl)-6-hexyl-4-(2-phenylethyl)-1,2,4-triazin-5-one (PubChem CID 154721217) has the molecular formula C18H23F2N3O and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-(difluoromethyl)-6-hexyl-4-(2-phenylethyl)-1,2,4-triazin-5-one.
| Compound Name | 3-(difluoromethyl)-6-hexyl-4-(2-phenylethyl)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 154721217 |
| Molecular Formula | C18H23F2N3O |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 3-(difluoromethyl)-6-hexyl-4-(2-phenylethyl)-1,2,4-triazin-5-one |
| SMILES | CCCCCCc1nnc(C(F)F)n(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C18H23F2N3O/c1-2-3-4-8-11-15-18(24)23(17(16(19)20)22-21-15)13-12-14-9-6-5-7-10-14/h5-7,9-10,16H,2-4,8,11-13H2,1H3 |
| InChIKey | GBSYYGNNLINQTJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|