C13H16O5 — CID 154721247
2-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethyl-2H-furan-5-one (PubChem CID 154721247) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethyl-2H-furan-5-one.
| Compound Name | 2-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethyl-2H-furan-5-one |
|---|---|
| PubChem CID | 154721247 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4-dimethyl-2H-furan-5-one |
| SMILES | CC1=C(C)C([C@]2(C)COC(=O)/C2=C(/C)O)OC1=O |
| InChI | InChI=1S/C13H16O5/c1-6-7(2)11(15)18-10(6)13(4)5-17-12(16)9(13)8(3)14/h10,14H,5H2,1-4H3/b9-8+/t10?,13-/m1/s1 |
| InChIKey | FLDANTFMRWYMGU-FINZDSTHSA-N |
| XLogP | 1.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|