C20H17N5S — CID 154721552
2-[[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 154721552) has the molecular formula C20H17N5S and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 154721552 |
| Molecular Formula | C20H17N5S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-[[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(/N=N/c2cc3c4c(c2)CCCN4CCC3)s1 |
| InChI | InChI=1S/C20H17N5S/c21-12-14(13-22)9-18-5-6-19(26-18)24-23-17-10-15-3-1-7-25-8-2-4-16(11-17)20(15)25/h5-6,9-11H,1-4,7-8H2/b24-23+ |
| InChIKey | JCHUPLSACGXWCF-WCWDXBQESA-N |
| XLogP | 5.29 |
| TPSA | 75.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|