C19H26O3 — CID 154721877
methyl (4S,5S,6Z)-4,5,6,8,10-pentamethyl-2-oxotricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate (PubChem CID 154721877) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl (4S,5S,6Z)-4,5,6,8,10-pentamethyl-2-oxotricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate.
| Compound Name | methyl (4S,5S,6Z)-4,5,6,8,10-pentamethyl-2-oxotricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
|---|---|
| PubChem CID | 154721877 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (4S,5S,6Z)-4,5,6,8,10-pentamethyl-2-oxotricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
| SMILES | COC(=O)C1C2C(=O)C[C@]3(C)C2C(C)=CC1(C)/C=C(/C)[C@@H]3C |
| InChI | InChI=1S/C19H26O3/c1-10-7-18(4)8-11(2)15-14(16(18)17(21)22-6)13(20)9-19(15,5)12(10)3/h7-8,12,14-16H,9H2,1-6H3/b10-7-/t12-,14?,15?,16?,18?,19-/m0/s1 |
| InChIKey | AODDWKFYMSPKSF-OIQPZDSPSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|