C13H16O4S — CID 154723088
(5R)-5-(benzenesulfonylmethyl)-3,3-dimethyloxolan-2-one (PubChem CID 154723088) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is (5R)-5-(benzenesulfonylmethyl)-3,3-dimethyloxolan-2-one.
| Compound Name | (5R)-5-(benzenesulfonylmethyl)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 154723088 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (5R)-5-(benzenesulfonylmethyl)-3,3-dimethyloxolan-2-one |
| SMILES | CC1(C)C[C@H](CS(=O)(=O)c2ccccc2)OC1=O |
| InChI | InChI=1S/C13H16O4S/c1-13(2)8-10(17-12(13)14)9-18(15,16)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | JZXBNJGJERGKIW-SNVBAGLBSA-N |
| XLogP | 1.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |