C18H36N6O6 — CID 154723837
N-[(1S,2S,3R,4R,5S,6R)-4-amino-3-[(2S,3S,6R)-3-amino-6-[(1R)-1-aminoethyl]oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide (PubChem CID 154723837) has the molecular formula C18H36N6O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(1S,2S,3R,4R,5S,6R)-4-amino-3-[(2S,3S,6R)-3-amino-6-[(1R)-1-aminoethyl]oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide.
| Compound Name | N-[(1S,2S,3R,4R,5S,6R)-4-amino-3-[(2S,3S,6R)-3-amino-6-[(1R)-1-aminoethyl]oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide |
|---|---|
| PubChem CID | 154723837 |
| Molecular Formula | C18H36N6O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | N-[(1S,2S,3R,4R,5S,6R)-4-amino-3-[(2S,3S,6R)-3-amino-6-[(1R)-1-aminoethyl]oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide |
| SMILES | CO[C@H]1[C@@H](O)[C@@H](N)[C@@H](O[C@@H]2O[C@@H]([C@@H](C)N)CC[C@@H]2N)[C@@H](O)[C@@H]1N(C)C(=O)C/N=C/N |
| InChI | InChI=1S/C18H36N6O6/c1-8(20)10-5-4-9(21)18(29-10)30-16-12(22)14(26)17(28-3)13(15(16)27)24(2)11(25)6-23-7-19/h7-10,12-18,26-27H,4-6,20-22H2,1-3H3,(H2,19,23)/t8-,9+,10-,12-,13+,14+,15+,16-,17-,18+/m1/s1 |
| InChIKey | VFBPKQSATYZKRX-MQRQECRASA-N |
| XLogP | -3.56 |
| TPSA | 204.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|