C35H47O2P — CID 154726595
2-bis(3,5-ditert-butylphenyl)phosphanylbenzoic acid (PubChem CID 154726595) has the molecular formula C35H47O2P and a molecular weight of 530.73 g/mol. Its IUPAC name is 2-bis(3,5-ditert-butylphenyl)phosphanylbenzoic acid.
| Compound Name | 2-bis(3,5-ditert-butylphenyl)phosphanylbenzoic acid |
|---|---|
| PubChem CID | 154726595 |
| Molecular Formula | C35H47O2P |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 2-bis(3,5-ditert-butylphenyl)phosphanylbenzoic acid |
| SMILES | CC(C)(C)c1cc(P(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccc2C(=O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H47O2P/c1-32(2,3)23-17-24(33(4,5)6)20-27(19-23)38(30-16-14-13-15-29(30)31(36)37)28-21-25(34(7,8)9)18-26(22-28)35(10,11)12/h13-22H,1-12H3,(H,36,37) |
| InChIKey | KHKJGQRLZXPNCD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|