C13H22O3 — CID 154731540
[(2S,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl] acetate (PubChem CID 154731540) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [(2S,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl] acetate.
| Compound Name | [(2S,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl] acetate |
|---|---|
| PubChem CID | 154731540 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(2S,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl] acetate |
| SMILES | C=C[C@@H](C)[C@H]1O[C@@H](OC(C)=O)[C@H](C)C[C@H]1C |
| InChI | InChI=1S/C13H22O3/c1-6-8(2)12-9(3)7-10(4)13(16-12)15-11(5)14/h6,8-10,12-13H,1,7H2,2-5H3/t8-,9-,10-,12-,13-/m1/s1 |
| InChIKey | QPJDBTCKGMAHRN-AIPRNEOBSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|