C14H17FN2O3 — CID 154738314
7-fluoro-1-(3-hydroxy-3-methylbutyl)-6-methoxyquinazolin-4-one (PubChem CID 154738314) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 7-fluoro-1-(3-hydroxy-3-methylbutyl)-6-methoxyquinazolin-4-one.
| Compound Name | 7-fluoro-1-(3-hydroxy-3-methylbutyl)-6-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 154738314 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 7-fluoro-1-(3-hydroxy-3-methylbutyl)-6-methoxyquinazolin-4-one |
| SMILES | COc1cc2c(=O)ncn(CCC(C)(C)O)c2cc1F |
| InChI | InChI=1S/C14H17FN2O3/c1-14(2,19)4-5-17-8-16-13(18)9-6-12(20-3)10(15)7-11(9)17/h6-8,19H,4-5H2,1-3H3 |
| InChIKey | MHYAWKMHYJDYBE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |