C12H10FN3O2 — CID 168870381
8-fluoro-7-methoxy-5-methyl-3H-pyridazino[4,5-b]indol-4-one (PubChem CID 168870381) has the molecular formula C12H10FN3O2 and a molecular weight of 247.23 g/mol. Its IUPAC name is 8-fluoro-7-methoxy-5-methyl-3H-pyridazino[4,5-b]indol-4-one.
| Compound Name | 8-fluoro-7-methoxy-5-methyl-3H-pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 168870381 |
| Molecular Formula | C12H10FN3O2 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 8-fluoro-7-methoxy-5-methyl-3H-pyridazino[4,5-b]indol-4-one |
| SMILES | COc1cc2c(cc1F)c1cn[nH]c(=O)c1n2C |
| InChI | InChI=1S/C12H10FN3O2/c1-16-9-4-10(18-2)8(13)3-6(9)7-5-14-15-12(17)11(7)16/h3-5H,1-2H3,(H,15,17) |
| InChIKey | XLBZSNRBXQCYMK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |