C15H11N3O2 — CID 141114307
3-methoxy-10,14,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11,15-heptaen-13-one (PubChem CID 141114307) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-methoxy-10,14,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11,15-heptaen-13-one.
| Compound Name | 3-methoxy-10,14,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11,15-heptaen-13-one |
|---|---|
| PubChem CID | 141114307 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-methoxy-10,14,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2(7),3,5,8,11,15-heptaen-13-one |
| SMILES | COc1cccc2ccn3cc4c(=O)[nH]ncc4c3c12 |
| InChI | InChI=1S/C15H11N3O2/c1-20-12-4-2-3-9-5-6-18-8-11-10(14(18)13(9)12)7-16-17-15(11)19/h2-8H,1H3,(H,17,19) |
| InChIKey | XSEZFVSOEWWMAA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |