C10H9N3OS2 — CID 156656208
7-methyl-4-methylsulfanyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 156656208) has the molecular formula C10H9N3OS2 and a molecular weight of 251.34 g/mol. Its IUPAC name is 7-methyl-4-methylsulfanyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 7-methyl-4-methylsulfanyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 156656208 |
| Molecular Formula | C10H9N3OS2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 7-methyl-4-methylsulfanyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | CSc1cc2c(s1)c1cn[nH]c(=O)c1n2C |
| InChI | InChI=1S/C10H9N3OS2/c1-13-6-3-7(15-2)16-9(6)5-4-11-12-10(14)8(5)13/h3-4H,1-2H3,(H,12,14) |
| InChIKey | IANUGLYUKNYYRV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |