C12H9FN6OS — CID 149329400
4-[(4-fluoro-1H-pyrazol-5-yl)methyl]-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 149329400) has the molecular formula C12H9FN6OS and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-[(4-fluoro-1H-pyrazol-5-yl)methyl]-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-[(4-fluoro-1H-pyrazol-5-yl)methyl]-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 149329400 |
| Molecular Formula | C12H9FN6OS |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[(4-fluoro-1H-pyrazol-5-yl)methyl]-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(Cc3[nH]ncc3F)sc2c2cn[nH]c(=O)c21 |
| InChI | InChI=1S/C12H9FN6OS/c1-19-9-5(3-14-18-12(9)20)10-11(19)16-8(21-10)2-7-6(13)4-15-17-7/h3-4H,2H2,1H3,(H,15,17)(H,18,20) |
| InChIKey | YCACOTYNEFIESY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |