C16H17F3N4O — CID 154738968
(1-tert-butyl-1,2,4-triazol-3-yl)-(5,6,7-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 154738968) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is (1-tert-butyl-1,2,4-triazol-3-yl)-(5,6,7-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (1-tert-butyl-1,2,4-triazol-3-yl)-(5,6,7-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 154738968 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (1-tert-butyl-1,2,4-triazol-3-yl)-(5,6,7-trifluoro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | CC(C)(C)n1cnc(C(=O)N2CCCc3c2cc(F)c(F)c3F)n1 |
| InChI | InChI=1S/C16H17F3N4O/c1-16(2,3)23-8-20-14(21-23)15(24)22-6-4-5-9-11(22)7-10(17)13(19)12(9)18/h7-8H,4-6H2,1-3H3 |
| InChIKey | OAYWWABRCIROFP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|