C12H20N4O3S — CID 154739659
1-(1,1-dioxothiolan-3-yl)-3-[1-(2-methylpropyl)pyrazol-4-yl]urea (PubChem CID 154739659) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[1-(2-methylpropyl)pyrazol-4-yl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[1-(2-methylpropyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 154739659 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[1-(2-methylpropyl)pyrazol-4-yl]urea |
| SMILES | CC(C)Cn1cc(NC(=O)NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C12H20N4O3S/c1-9(2)6-16-7-11(5-13-16)15-12(17)14-10-3-4-20(18,19)8-10/h5,7,9-10H,3-4,6,8H2,1-2H3,(H2,14,15,17) |
| InChIKey | DCOJSRMOCGWRLX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |