C12H17FN2O4S — CID 154740202
2-fluoro-4-methyl-6-[[methyl(propyl)sulfamoyl]amino]benzoic acid (PubChem CID 154740202) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-fluoro-4-methyl-6-[[methyl(propyl)sulfamoyl]amino]benzoic acid.
| Compound Name | 2-fluoro-4-methyl-6-[[methyl(propyl)sulfamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 154740202 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-fluoro-4-methyl-6-[[methyl(propyl)sulfamoyl]amino]benzoic acid |
| SMILES | CCCN(C)S(=O)(=O)Nc1cc(C)cc(F)c1C(=O)O |
| InChI | InChI=1S/C12H17FN2O4S/c1-4-5-15(3)20(18,19)14-10-7-8(2)6-9(13)11(10)12(16)17/h6-7,14H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | CHAIKCDTIFCASI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |