C10H14BFN2O2S — CID 172569700
CID 172569700 (PubChem CID 172569700) has the molecular formula C10H14BFN2O2S and a molecular weight of 256.11 g/mol.
| Compound Name | CID 172569700 |
|---|---|
| PubChem CID | 172569700 |
| Molecular Formula | C10H14BFN2O2S |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C)cc(NS(=O)(=O)N(C)CC)c1F |
| InChI | InChI=1S/C10H14BFN2O2S/c1-4-14(3)17(15,16)13-9-6-7(2)5-8(11)10(9)12/h5-6,13H,4H2,1-3H3 |
| InChIKey | QJSGNYCQSIVWMJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|