C6HF9 — CID 15474242
3,3,4,4,5,5-hexafluoro-1-(trifluoromethyl)cyclopentene (PubChem CID 15474242) has the molecular formula C6HF9 and a molecular weight of 244.06 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(trifluoromethyl)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 15474242 |
| Molecular Formula | C6HF9 |
| Molecular Weight | 244.06 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethyl)cyclopentene |
| SMILES | FC(F)(F)C1=CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HF9/c7-3(8)1-2(5(11,12)13)4(9,10)6(3,14)15/h1H |
| InChIKey | HZKOWJLMLRREEX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.06 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|