C16H23ClS — CID 15474632
(2R,3S,4S)-4-chloro-3-pentyl-2-phenylthiane (PubChem CID 15474632) has the molecular formula C16H23ClS and a molecular weight of 282.88 g/mol. Its IUPAC name is (2R,3S,4S)-4-chloro-3-pentyl-2-phenylthiane.
| Compound Name | (2R,3S,4S)-4-chloro-3-pentyl-2-phenylthiane |
|---|---|
| PubChem CID | 15474632 |
| Molecular Formula | C16H23ClS |
| Molecular Weight | 282.88 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2R,3S,4S)-4-chloro-3-pentyl-2-phenylthiane |
| SMILES | CCCCCC1[C@@H](Cl)CCS[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23ClS/c1-2-3-5-10-14-15(17)11-12-18-16(14)13-8-6-4-7-9-13/h4,6-9,14-16H,2-3,5,10-12H2,1H3/t14?,15-,16-/m0/s1 |
| InChIKey | IDFJLHXNNMIHPZ-YVZMLIKISA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.88 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|