C21H24Cl2N2O3 — CID 154747713
N'-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-(3-chloro-4-propoxyphenyl)oxamide (PubChem CID 154747713) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is N'-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-(3-chloro-4-propoxyphenyl)oxamide.
| Compound Name | N'-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-(3-chloro-4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 154747713 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N'-[1-(2-chlorophenyl)-2-methylpropan-2-yl]-N-(3-chloro-4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)NC(C)(C)Cc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O3/c1-4-11-28-18-10-9-15(12-17(18)23)24-19(26)20(27)25-21(2,3)13-14-7-5-6-8-16(14)22/h5-10,12H,4,11,13H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | HPEMBBXUGVGEDU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|