C15H25ClN4O2 — CID 154750190
N-butan-2-yl-2-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]propanamide (PubChem CID 154750190) has the molecular formula C15H25ClN4O2 and a molecular weight of 328.84 g/mol. Its IUPAC name is N-butan-2-yl-2-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-2-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]propanamide |
|---|---|
| PubChem CID | 154750190 |
| Molecular Formula | C15H25ClN4O2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-butan-2-yl-2-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)NC(=O)N(C)Cc1cc(Cl)cn1C |
| InChI | InChI=1S/C15H25ClN4O2/c1-6-10(2)17-14(21)11(3)18-15(22)20(5)9-13-7-12(16)8-19(13)4/h7-8,10-11H,6,9H2,1-5H3,(H,17,21)(H,18,22) |
| InChIKey | RJTCAJDNTPEEEA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |