C18H21N7O — CID 154758829
N-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indole-2-carboxamide (PubChem CID 154758829) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indole-2-carboxamide.
| Compound Name | N-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indole-2-carboxamide |
|---|---|
| PubChem CID | 154758829 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,3,4,5,11,11a-hexahydro-[1,4]diazepino[1,2-a]indole-2-carboxamide |
| SMILES | N#Cc1ncn(CCNC(=O)N2CCCN3c4ccccc4CC3C2)n1 |
| InChI | InChI=1S/C18H21N7O/c19-11-17-21-13-24(22-17)9-6-20-18(26)23-7-3-8-25-15(12-23)10-14-4-1-2-5-16(14)25/h1-2,4-5,13,15H,3,6-10,12H2,(H,20,26) |
| InChIKey | LQLSZTHXDRRTIJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |