C16H12ClN3O2S — CID 154762888
prop-2-enyl 3-(2-anilino-4-chloro-1,3-thiazol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 154762888) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is prop-2-enyl 3-(2-anilino-4-chloro-1,3-thiazol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | prop-2-enyl 3-(2-anilino-4-chloro-1,3-thiazol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 154762888 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | prop-2-enyl 3-(2-anilino-4-chloro-1,3-thiazol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | C=CCOC(=O)C(C#N)=Cc1sc(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/C16H12ClN3O2S/c1-2-8-22-15(21)11(10-18)9-13-14(17)20-16(23-13)19-12-6-4-3-5-7-12/h2-7,9H,1,8H2,(H,19,20) |
| InChIKey | KJOBDDNATYTMQP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|