C10H10BrClN2O4 — CID 154765022
methyl (2S)-2-[(5-bromo-4-chloropyridine-2-carbonyl)amino]-3-hydroxypropanoate (PubChem CID 154765022) has the molecular formula C10H10BrClN2O4 and a molecular weight of 337.56 g/mol. Its IUPAC name is methyl (2S)-2-[(5-bromo-4-chloropyridine-2-carbonyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[(5-bromo-4-chloropyridine-2-carbonyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 154765022 |
| Molecular Formula | C10H10BrClN2O4 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | methyl (2S)-2-[(5-bromo-4-chloropyridine-2-carbonyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1cc(Cl)c(Br)cn1 |
| InChI | InChI=1S/C10H10BrClN2O4/c1-18-10(17)8(4-15)14-9(16)7-2-6(12)5(11)3-13-7/h2-3,8,15H,4H2,1H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | JICLNPQBOZUUNF-QMMMGPOBSA-N |
| XLogP | 0.76 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |