C14H22N4O3 — CID 154771376
1-[(1R,2S)-2-(oxan-3-ylamino)cyclohexyl]triazole-4-carboxylic acid (PubChem CID 154771376) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(oxan-3-ylamino)cyclohexyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(1R,2S)-2-(oxan-3-ylamino)cyclohexyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 154771376 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[(1R,2S)-2-(oxan-3-ylamino)cyclohexyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn([C@@H]2CCCC[C@@H]2NC2CCCOC2)nn1 |
| InChI | InChI=1S/C14H22N4O3/c19-14(20)12-8-18(17-16-12)13-6-2-1-5-11(13)15-10-4-3-7-21-9-10/h8,10-11,13,15H,1-7,9H2,(H,19,20)/t10?,11-,13+/m0/s1 |
| InChIKey | JXZGOJDYTMRGGM-QMDRTORHSA-N |
| XLogP | 1.23 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |