About 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid
1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid (PubChem CID 166377079) has the molecular formula C16H19FN4O4S
and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid |
| PubChem CID | 166377079 |
| Molecular Formula | C16H19FN4O4S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn([C@@H]2CCCC[C@@H]2NS(=O)(=O)Cc2ccccc2F)nn1 |
| InChI | InChI=1S/C16H19FN4O4S/c17-12-6-2-1-5-11(12)10-26(24,25)19-13-7-3-4-8-15(13)21-9-14(16(22)23)18-20-21/h1-2,5-6,9,13,15,19H,3-4,7-8,10H2,(H,22,23)/t13-,15+/m0/s1 |
| InChIKey | OUEOCPDSZUDPOG-DZGCQCFKSA-N |
| XLogP | 1.72 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid (CID 166377079) is 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid is O=C(O)c1cn([C@@H]2CCCC[C@@H]2NS(=O)(=O)Cc2ccccc2F)nn1.
What is the InChIKey of 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid?
The InChIKey is OUEOCPDSZUDPOG-DZGCQCFKSA-N. The full InChI is InChI=1S/C16H19FN4O4S/c17-12-6-2-1-5-11(12)10-26(24,25)19-13-7-3-4-8-15(13)21-9-14(16(22)23)18-20-21/h1-2,5-6,9,13,15,19H,3-4,7-8,10H2,(H,22,23)/t13-,15+/m0/s1.
What are the key properties of 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid?
1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid has a molecular weight of 382.42 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-2-[(2-fluorophenyl)methylsulfonylamino]cyclohexyl]triazole-4-carboxylic acid is sourced from PubChem (CID 166377079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).