C18H27N5O3 — CID 154775940
2-methyl-1-[4-[2-(triazol-2-yl)acetyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]pent-2-en-1-one (PubChem CID 154775940) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-methyl-1-[4-[2-(triazol-2-yl)acetyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]pent-2-en-1-one.
| Compound Name | 2-methyl-1-[4-[2-(triazol-2-yl)acetyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 154775940 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-methyl-1-[4-[2-(triazol-2-yl)acetyl]-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]pent-2-en-1-one |
| SMILES | CCC=C(C)C(=O)N1CCC2(CC1)CN(C(=O)Cn1nccn1)CCO2 |
| InChI | InChI=1S/C18H27N5O3/c1-3-4-15(2)17(25)21-9-5-18(6-10-21)14-22(11-12-26-18)16(24)13-23-19-7-8-20-23/h4,7-8H,3,5-6,9-14H2,1-2H3 |
| InChIKey | ALPDERMFVOWVDZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|