About propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride
propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride (PubChem CID 154776096) has the molecular formula C7H17ClN2O2
and a molecular weight of 196.68 g/mol. Its IUPAC name is propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride |
| PubChem CID | 154776096 |
| Molecular Formula | C7H17ClN2O2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride |
| SMILES | CNC[C@H](N)C(=O)OC(C)C.Cl |
| InChI | InChI=1S/C7H16N2O2.ClH/c1-5(2)11-7(10)6(8)4-9-3;/h5-6,9H,4,8H2,1-3H3;1H/t6-;/m0./s1 |
| InChIKey | YBRRVPLMKZMHJF-RGMNGODLSA-N |
| XLogP | -0.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride?
The IUPAC name of propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride (CID 154776096) is propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride.
What is the SMILES notation for propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride?
The canonical SMILES for propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride is CNC[C@H](N)C(=O)OC(C)C.Cl.
What is the InChIKey of propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride?
The InChIKey is YBRRVPLMKZMHJF-RGMNGODLSA-N. The full InChI is InChI=1S/C7H16N2O2.ClH/c1-5(2)11-7(10)6(8)4-9-3;/h5-6,9H,4,8H2,1-3H3;1H/t6-;/m0./s1.
What are the key properties of propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride?
propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride has a molecular weight of 196.68 g/mol, XLogP of -0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride is sourced from PubChem (CID 154776096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).