C15H22N4O — CID 154776384
(3aS,8aR)-1-methyl-N-pyridin-3-yl-2,3,4,5,6,7,8,8a-octahydropyrrolo[2,3-d]azepine-3a-carboxamide (PubChem CID 154776384) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (3aS,8aR)-1-methyl-N-pyridin-3-yl-2,3,4,5,6,7,8,8a-octahydropyrrolo[2,3-d]azepine-3a-carboxamide.
| Compound Name | (3aS,8aR)-1-methyl-N-pyridin-3-yl-2,3,4,5,6,7,8,8a-octahydropyrrolo[2,3-d]azepine-3a-carboxamide |
|---|---|
| PubChem CID | 154776384 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (3aS,8aR)-1-methyl-N-pyridin-3-yl-2,3,4,5,6,7,8,8a-octahydropyrrolo[2,3-d]azepine-3a-carboxamide |
| SMILES | CN1CC[C@@]2(C(=O)Nc3cccnc3)CCNCC[C@@H]12 |
| InChI | InChI=1S/C15H22N4O/c1-19-10-6-15(5-9-16-8-4-13(15)19)14(20)18-12-3-2-7-17-11-12/h2-3,7,11,13,16H,4-6,8-10H2,1H3,(H,18,20)/t13-,15+/m1/s1 |
| InChIKey | KAVHZHSNQGMUGN-HIFRSBDPSA-N |
| XLogP | 1.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |