C24H32F6N4O6 — CID 127023368
(3aR,8aR)-1-methyl-6-(3-methylbutanoyl)-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023368) has the molecular formula C24H32F6N4O6 and a molecular weight of 586.53 g/mol. Its IUPAC name is (3aR,8aR)-1-methyl-6-(3-methylbutanoyl)-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,8aR)-1-methyl-6-(3-methylbutanoyl)-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023368 |
| Molecular Formula | C24H32F6N4O6 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | (3aR,8aR)-1-methyl-6-(3-methylbutanoyl)-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)CC(=O)N1CC[C@H]2N(C)CC[C@@]2(C(=O)Nc2cccnc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N4O2.2C2HF3O2/c1-15(2)13-18(25)24-10-6-17-20(8-12-24,7-11-23(17)3)19(26)22-16-5-4-9-21-14-16;2*3-2(4,5)1(6)7/h4-5,9,14-15,17H,6-8,10-13H2,1-3H3,(H,22,26);2*(H,6,7)/t17-,20-;;/m1../s1 |
| InChIKey | QGSPZAYVYABBBY-FDCKWBIYSA-N |
| XLogP | 3.65 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |