C26H28ClF6N5O6 — CID 155855300
(3aR,8aR)-6-N-(4-chlorophenyl)-1-methyl-3a-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155855300) has the molecular formula C26H28ClF6N5O6 and a molecular weight of 655.98 g/mol. Its IUPAC name is (3aR,8aR)-6-N-(4-chlorophenyl)-1-methyl-3a-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,8aR)-6-N-(4-chlorophenyl)-1-methyl-3a-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155855300 |
| Molecular Formula | C26H28ClF6N5O6 |
| Molecular Weight | 655.98 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | (3aR,8aR)-6-N-(4-chlorophenyl)-1-methyl-3a-N-pyridin-3-yl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CC[C@@]2(C(=O)Nc3cccnc3)CCN(C(=O)Nc3ccc(Cl)cc3)CC[C@@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26ClN5O2.2C2HF3O2/c1-27-13-9-22(20(29)25-18-3-2-11-24-15-18)10-14-28(12-8-19(22)27)21(30)26-17-6-4-16(23)5-7-17;2*3-2(4,5)1(6)7/h2-7,11,15,19H,8-10,12-14H2,1H3,(H,25,29)(H,26,30);2*(H,6,7)/t19-,22-;;/m1../s1 |
| InChIKey | HBUBLOLZKIBEDV-WYWDDXCHSA-N |
| XLogP | 4.96 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |