C17H19N5O2 — CID 154780871
3-(1-benzyl-1,2,4-triazol-3-yl)-1-cyclobutyl-5-methylimidazolidine-2,4-dione (PubChem CID 154780871) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-(1-benzyl-1,2,4-triazol-3-yl)-1-cyclobutyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(1-benzyl-1,2,4-triazol-3-yl)-1-cyclobutyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154780871 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-(1-benzyl-1,2,4-triazol-3-yl)-1-cyclobutyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC1C(=O)N(c2ncn(Cc3ccccc3)n2)C(=O)N1C1CCC1 |
| InChI | InChI=1S/C17H19N5O2/c1-12-15(23)22(17(24)21(12)14-8-5-9-14)16-18-11-20(19-16)10-13-6-3-2-4-7-13/h2-4,6-7,11-12,14H,5,8-10H2,1H3 |
| InChIKey | URIAMKLOBSSSTB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|