C10H10F2N6O2 — CID 154783980
5-(difluoromethoxy)-N-(2-ethyltetrazol-5-yl)pyridine-2-carboxamide (PubChem CID 154783980) has the molecular formula C10H10F2N6O2 and a molecular weight of 284.23 g/mol. Its IUPAC name is 5-(difluoromethoxy)-N-(2-ethyltetrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 5-(difluoromethoxy)-N-(2-ethyltetrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154783980 |
| Molecular Formula | C10H10F2N6O2 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-(difluoromethoxy)-N-(2-ethyltetrazol-5-yl)pyridine-2-carboxamide |
| SMILES | CCn1nnc(NC(=O)c2ccc(OC(F)F)cn2)n1 |
| InChI | InChI=1S/C10H10F2N6O2/c1-2-18-16-10(15-17-18)14-8(19)7-4-3-6(5-13-7)20-9(11)12/h3-5,9H,2H2,1H3,(H,14,16,19) |
| InChIKey | JZPYMHUPEAOBLU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |