C6H18N6O3 — CID 154792768
N,N-bis(trideuteriomethyl)nitrous amide (PubChem CID 154792768) has the molecular formula C6H18N6O3 and a molecular weight of 240.36 g/mol. Its IUPAC name is N,N-bis(trideuteriomethyl)nitrous amide.
| Compound Name | N,N-bis(trideuteriomethyl)nitrous amide |
|---|---|
| PubChem CID | 154792768 |
| Molecular Formula | C6H18N6O3 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N,N-bis(trideuteriomethyl)nitrous amide |
| SMILES | [2H]C([2H])([2H])N(N=O)C([2H])([2H])[2H].[2H]C([2H])([2H])N(N=O)C([2H])([2H])[2H].[2H]C([2H])([2H])N(N=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/3C2H6N2O/c3*1-4(2)3-5/h3*1-2H3/i3*1D3,2D3 |
| InChIKey | DINVQUZBIQHAPA-CVFZNTDSSA-N |
| XLogP | 0.69 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|