C10H24N4O2 — CID 159809531
N,N-dibutylnitrous amide;N,N-dimethylnitrous amide (PubChem CID 159809531) has the molecular formula C10H24N4O2 and a molecular weight of 232.33 g/mol. Its IUPAC name is N,N-dibutylnitrous amide;N,N-dimethylnitrous amide.
| Compound Name | N,N-dibutylnitrous amide;N,N-dimethylnitrous amide |
|---|---|
| PubChem CID | 159809531 |
| Molecular Formula | C10H24N4O2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N,N-dibutylnitrous amide;N,N-dimethylnitrous amide |
| SMILES | CCCCN(CCCC)N=O.CN(C)N=O |
| InChI | InChI=1S/C8H18N2O.C2H6N2O/c1-3-5-7-10(9-11)8-6-4-2;1-4(2)3-5/h3-8H2,1-2H3;1-2H3 |
| InChIKey | NKVPAMSNQBQEFT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|