About N-amino-N-ethylnitrous amide
N-amino-N-ethylnitrous amide (PubChem CID 23266213) has the molecular formula C2H7N3O
and a molecular weight of 89.10 g/mol. Its IUPAC name is N-amino-N-ethylnitrous amide.
Molecular Properties
| Compound Name | N-amino-N-ethylnitrous amide |
| PubChem CID | 23266213 |
| Molecular Formula | C2H7N3O |
| Molecular Weight | 89.10 g/mol |
| Exact Mass | 89.06 |
| IUPAC Name | N-amino-N-ethylnitrous amide |
| SMILES | CCN(N)N=O |
| InChI | InChI=1S/C2H7N3O/c1-2-5(3)4-6/h2-3H2,1H3 |
| InChIKey | CGQSTTKBCCKMMD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.10 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-ethylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-ethylnitrous amide?
The IUPAC name of N-amino-N-ethylnitrous amide (CID 23266213) is N-amino-N-ethylnitrous amide.
What is the SMILES notation for N-amino-N-ethylnitrous amide?
The canonical SMILES for N-amino-N-ethylnitrous amide is CCN(N)N=O.
What is the InChIKey of N-amino-N-ethylnitrous amide?
The InChIKey is CGQSTTKBCCKMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3O/c1-2-5(3)4-6/h2-3H2,1H3.
What are the key properties of N-amino-N-ethylnitrous amide?
N-amino-N-ethylnitrous amide has a molecular weight of 89.10 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-ethylnitrous amide is sourced from PubChem (CID 23266213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).