About 1-ethyl-1-nitrosourea
1-ethyl-1-nitrosourea (PubChem CID 159023173) has the molecular formula C6H14N6O4
and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-ethyl-1-nitrosourea.
Molecular Properties
| Compound Name | 1-ethyl-1-nitrosourea |
| PubChem CID | 159023173 |
| Molecular Formula | C6H14N6O4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-ethyl-1-nitrosourea |
| SMILES | CCN(N=O)C(N)=O.CCN(N=O)C(N)=O |
| InChI | InChI=1S/2C3H7N3O2/c2*1-2-6(5-8)3(4)7/h2*2H2,1H3,(H2,4,7) |
| InChIKey | JTYNCDFTNAAKGA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-nitrosourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-nitrosourea?
The IUPAC name of 1-ethyl-1-nitrosourea (CID 159023173) is 1-ethyl-1-nitrosourea.
What is the SMILES notation for 1-ethyl-1-nitrosourea?
The canonical SMILES for 1-ethyl-1-nitrosourea is CCN(N=O)C(N)=O.CCN(N=O)C(N)=O.
What is the InChIKey of 1-ethyl-1-nitrosourea?
The InChIKey is JTYNCDFTNAAKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7N3O2/c2*1-2-6(5-8)3(4)7/h2*2H2,1H3,(H2,4,7).
What are the key properties of 1-ethyl-1-nitrosourea?
1-ethyl-1-nitrosourea has a molecular weight of 234.22 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-nitrosourea is sourced from PubChem (CID 159023173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).