C3H8N2O — CID 171380411
N-(1,2-13C2)ethyl-N-(113C)methylnitrous amide (PubChem CID 171380411) has the molecular formula C3H8N2O and a molecular weight of 91.09 g/mol. Its IUPAC name is N-(1,2-13C2)ethyl-N-(113C)methylnitrous amide.
| Compound Name | N-(1,2-13C2)ethyl-N-(113C)methylnitrous amide |
|---|---|
| PubChem CID | 171380411 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 91.09 g/mol |
| Exact Mass | 91.07 |
| IUPAC Name | N-(1,2-13C2)ethyl-N-(113C)methylnitrous amide |
| SMILES | [13CH3][13CH2]N([13CH3])N=O |
| InChI | InChI=1S/C3H8N2O/c1-3-5(2)4-6/h3H2,1-2H3/i1+1,2+1,3+1 |
| InChIKey | RTDCJKARQCRONF-VMIGTVKRSA-N |
| XLogP | 0.62 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 91.09 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|