C3H6Cl2N2O — CID 162512703
N-(2,2-dichloroethyl)-N-methylnitrous amide (PubChem CID 162512703) has the molecular formula C3H6Cl2N2O and a molecular weight of 157.00 g/mol. Its IUPAC name is N-(2,2-dichloroethyl)-N-methylnitrous amide.
| Compound Name | N-(2,2-dichloroethyl)-N-methylnitrous amide |
|---|---|
| PubChem CID | 162512703 |
| Molecular Formula | C3H6Cl2N2O |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 155.99 |
| IUPAC Name | N-(2,2-dichloroethyl)-N-methylnitrous amide |
| SMILES | CN(CC(Cl)Cl)N=O |
| InChI | InChI=1S/C3H6Cl2N2O/c1-7(6-8)2-3(4)5/h3H,2H2,1H3 |
| InChIKey | UIBNBNMKTAKVDC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|