C23H32N6O3 — CID 11037551
N-methyl-N-[(2S)-2-[[(2S)-2-[2-methylpropyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide (PubChem CID 11037551) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-methyl-N-[(2S)-2-[[(2S)-2-[2-methylpropyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide.
| Compound Name | N-methyl-N-[(2S)-2-[[(2S)-2-[2-methylpropyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide |
|---|---|
| PubChem CID | 11037551 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-methyl-N-[(2S)-2-[[(2S)-2-[2-methylpropyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide |
| SMILES | CC(C)CN(N=O)[C@@H](Cc1ccccc1)CN(N=O)[C@@H](Cc1ccccc1)CN(C)N=O |
| InChI | InChI=1S/C23H32N6O3/c1-19(2)16-28(25-31)23(15-21-12-8-5-9-13-21)18-29(26-32)22(17-27(3)24-30)14-20-10-6-4-7-11-20/h4-13,19,22-23H,14-18H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | KTCWNRNOXRFDOY-GOTSBHOMSA-N |
| XLogP | 4.45 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|