C24H34N6NaO3+ — CID 56642884
sodium N-methyl-N-[(2S)-2-[[(2S)-2-[3-methylbutyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide (PubChem CID 56642884) has the molecular formula C24H34N6NaO3+ and a molecular weight of 477.57 g/mol. Its IUPAC name is sodium N-methyl-N-[(2S)-2-[[(2S)-2-[3-methylbutyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide.
| Compound Name | sodium N-methyl-N-[(2S)-2-[[(2S)-2-[3-methylbutyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide |
|---|---|
| PubChem CID | 56642884 |
| Molecular Formula | C24H34N6NaO3+ |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | sodium N-methyl-N-[(2S)-2-[[(2S)-2-[3-methylbutyl(nitroso)amino]-3-phenylpropyl]-nitrosoamino]-3-phenylpropyl]nitrous amide |
| SMILES | CC(C)CCN(N=O)[C@@H](Cc1ccccc1)CN(N=O)[C@@H](Cc1ccccc1)CN(C)N=O.[Na+] |
| InChI | InChI=1S/C24H34N6O3.Na/c1-20(2)14-15-29(26-32)24(17-22-12-8-5-9-13-22)19-30(27-33)23(18-28(3)25-31)16-21-10-6-4-7-11-21;/h4-13,20,23-24H,14-19H2,1-3H3;/q;+1/t23-,24-;/m0./s1 |
| InChIKey | UNHZFETYEMDHIF-UKOKCHKQSA-N |
| XLogP | 1.84 |
| TPSA | 98.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|