C11H14N2O3 — CID 92856182
2-[nitroso-[(2S)-1-phenylpropan-2-yl]amino]acetic acid (PubChem CID 92856182) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[nitroso-[(2S)-1-phenylpropan-2-yl]amino]acetic acid.
| Compound Name | 2-[nitroso-[(2S)-1-phenylpropan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 92856182 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-[nitroso-[(2S)-1-phenylpropan-2-yl]amino]acetic acid |
| SMILES | C[C@@H](Cc1ccccc1)N(CC(=O)O)N=O |
| InChI | InChI=1S/C11H14N2O3/c1-9(13(12-16)8-11(14)15)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | XXJRSFSDWBICFQ-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|