About 1,1-diethylhydrazine;ethene
1,1-diethylhydrazine;ethene (PubChem CID 87605670) has the molecular formula C6H16N2
and a molecular weight of 116.21 g/mol. Its IUPAC name is 1,1-diethylhydrazine;ethene.
Molecular Properties
| Compound Name | 1,1-diethylhydrazine;ethene |
| PubChem CID | 87605670 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | 1,1-diethylhydrazine;ethene |
| SMILES | C=C.CCN(N)CC |
| InChI | InChI=1S/C4H12N2.C2H4/c1-3-6(5)4-2;1-2/h3-5H2,1-2H3;1-2H2 |
| InChIKey | JGWMZEQUNOGJEX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethylhydrazine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylhydrazine;ethene?
The IUPAC name of 1,1-diethylhydrazine;ethene (CID 87605670) is 1,1-diethylhydrazine;ethene.
What is the SMILES notation for 1,1-diethylhydrazine;ethene?
The canonical SMILES for 1,1-diethylhydrazine;ethene is C=C.CCN(N)CC.
What is the InChIKey of 1,1-diethylhydrazine;ethene?
The InChIKey is JGWMZEQUNOGJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.C2H4/c1-3-6(5)4-2;1-2/h3-5H2,1-2H3;1-2H2.
What are the key properties of 1,1-diethylhydrazine;ethene?
1,1-diethylhydrazine;ethene has a molecular weight of 116.21 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylhydrazine;ethene is sourced from PubChem (CID 87605670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).