C17H24O6 — CID 154793066
ethyl (2E)-2-[(3'aS,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,7a-dihydro-1,3-benzodioxole]-4'-ylidene]acetate (PubChem CID 154793066) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is ethyl (2E)-2-[(3'aS,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,7a-dihydro-1,3-benzodioxole]-4'-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3'aS,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,7a-dihydro-1,3-benzodioxole]-4'-ylidene]acetate |
|---|---|
| PubChem CID | 154793066 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl (2E)-2-[(3'aS,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,7a-dihydro-1,3-benzodioxole]-4'-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C=C[C@@]2(COC(C)(C)O2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H24O6/c1-6-19-12(18)9-11-7-8-17(10-20-15(2,3)23-17)14-13(11)21-16(4,5)22-14/h7-9,13-14H,6,10H2,1-5H3/b11-9+/t13-,14-,17+/m0/s1 |
| InChIKey | GVVHQFKOUDDGRE-BAZAZJHESA-N |
| XLogP | 2.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|