C16H27NO4 — CID 154796496
methyl 4-hydroxy-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrrolidine-2-carboxylate (PubChem CID 154796496) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154796496 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | methyl 4-hydroxy-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1CC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C16H27NO4/c1-20-15(19)14-9-12(18)10-17(14)11-13-5-8-16(21-13)6-3-2-4-7-16/h12-14,18H,2-11H2,1H3 |
| InChIKey | AHHWBCFPWKRZND-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |