C19H17FN2O2 — CID 154798734
[3-(4-fluorophenyl)-3-hydroxypyrrolidin-1-yl]-indolizin-2-ylmethanone (PubChem CID 154798734) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-3-hydroxypyrrolidin-1-yl]-indolizin-2-ylmethanone.
| Compound Name | [3-(4-fluorophenyl)-3-hydroxypyrrolidin-1-yl]-indolizin-2-ylmethanone |
|---|---|
| PubChem CID | 154798734 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [3-(4-fluorophenyl)-3-hydroxypyrrolidin-1-yl]-indolizin-2-ylmethanone |
| SMILES | O=C(c1cc2ccccn2c1)N1CCC(O)(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H17FN2O2/c20-16-6-4-15(5-7-16)19(24)8-10-22(13-19)18(23)14-11-17-3-1-2-9-21(17)12-14/h1-7,9,11-12,24H,8,10,13H2 |
| InChIKey | MZRHOHUBZFDCBI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |