C16H20N4O6S — CID 154801237
4-methoxy-2-nitro-N-[[(2R,3S)-2-(1H-pyrazol-5-yl)oxan-3-yl]methyl]benzenesulfonamide (PubChem CID 154801237) has the molecular formula C16H20N4O6S and a molecular weight of 396.43 g/mol. Its IUPAC name is 4-methoxy-2-nitro-N-[[(2R,3S)-2-(1H-pyrazol-5-yl)oxan-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-nitro-N-[[(2R,3S)-2-(1H-pyrazol-5-yl)oxan-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154801237 |
| Molecular Formula | C16H20N4O6S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-methoxy-2-nitro-N-[[(2R,3S)-2-(1H-pyrazol-5-yl)oxan-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@@H]2CCCO[C@H]2c2ccn[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N4O6S/c1-25-12-4-5-15(14(9-12)20(21)22)27(23,24)18-10-11-3-2-8-26-16(11)13-6-7-17-19-13/h4-7,9,11,16,18H,2-3,8,10H2,1H3,(H,17,19)/t11-,16+/m0/s1 |
| InChIKey | SJJRKRCADMLZOV-MEDUHNTESA-N |
| XLogP | 1.77 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|