About N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine (PubChem CID 154807480) has the molecular formula C15H18BrN3O3
and a molecular weight of 368.23 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine |
| PubChem CID | 154807480 |
| Molecular Formula | C15H18BrN3O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine |
| SMILES | CC(Cn1cc(Br)cn1)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18BrN3O3/c1-11(8-19-9-12(16)7-18-19)17-4-5-20-13-2-3-14-15(6-13)22-10-21-14/h2-3,6-7,9,11,17H,4-5,8,10H2,1H3 |
| InChIKey | HJUXSURTYHPWDL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine?
The IUPAC name of N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine (CID 154807480) is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine.
What is the SMILES notation for N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine?
The canonical SMILES for N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine is CC(Cn1cc(Br)cn1)NCCOc1ccc2c(c1)OCO2.
What is the InChIKey of N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine?
The InChIKey is HJUXSURTYHPWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN3O3/c1-11(8-19-9-12(16)7-18-19)17-4-5-20-13-2-3-14-15(6-13)22-10-21-14/h2-3,6-7,9,11,17H,4-5,8,10H2,1H3.
What are the key properties of N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine?
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine has a molecular weight of 368.23 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(4-bromopyrazol-1-yl)propan-2-amine is sourced from PubChem (CID 154807480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).